C27H42Br2N2O3 — CID 70066132
(6S)-6-[6-[2-(3-hydroxyphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol;dihydrobromide (PubChem CID 70066132) has the molecular formula C27H42Br2N2O3 and a molecular weight of 602.45 g/mol. Its IUPAC name is (6S)-6-[6-[2-(3-hydroxyphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol;dihydrobromide.
| Compound Name | (6S)-6-[6-[2-(3-hydroxyphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol;dihydrobromide |
|---|---|
| PubChem CID | 70066132 |
| Molecular Formula | C27H42Br2N2O3 |
| Molecular Weight | 602.45 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | (6S)-6-[6-[2-(3-hydroxyphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol;dihydrobromide |
| SMILES | Br.Br.CCCN(CCCCCCNCCc1cccc(O)c1)[C@H]1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C27H40N2O3.2BrH/c1-2-17-29(23-11-12-25-22(20-23)10-13-26(31)27(25)32)18-6-4-3-5-15-28-16-14-21-8-7-9-24(30)19-21;;/h7-10,13,19,23,28,30-32H,2-6,11-12,14-18,20H2,1H3;2*1H/t23-;;/m0../s1 |
| InChIKey | BHAZYNGGSZEGMN-IFUPQEAVSA-N |
| XLogP | 5.92 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|