C28H42N2O4S — CID 22905967
6-[6-[2-(3-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 22905967) has the molecular formula C28H42N2O4S and a molecular weight of 502.72 g/mol. Its IUPAC name is 6-[6-[2-(3-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | 6-[6-[2-(3-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 22905967 |
| Molecular Formula | C28H42N2O4S |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 6-[6-[2-(3-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCN(CCCCCCNCCc1cccc(S(C)(=O)=O)c1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C28H42N2O4S/c1-3-18-30(24-12-13-26-23(21-24)11-14-27(31)28(26)32)19-7-5-4-6-16-29-17-15-22-9-8-10-25(20-22)35(2,33)34/h8-11,14,20,24,29,31-32H,3-7,12-13,15-19,21H2,1-2H3 |
| InChIKey | ARLGJOWHEVPIJA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|