C29H43N3O3 — CID 22906044
N-[4-[2-[6-[(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexylamino]ethyl]phenyl]acetamide (PubChem CID 22906044) has the molecular formula C29H43N3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is N-[4-[2-[6-[(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexylamino]ethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[6-[(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexylamino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 22906044 |
| Molecular Formula | C29H43N3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | N-[4-[2-[6-[(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexylamino]ethyl]phenyl]acetamide |
| SMILES | CCCN(CCCCCCNCCc1ccc(NC(C)=O)cc1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C29H43N3O3/c1-3-19-32(26-13-14-27-24(21-26)10-15-28(34)29(27)35)20-7-5-4-6-17-30-18-16-23-8-11-25(12-9-23)31-22(2)33/h8-12,15,26,30,34-35H,3-7,13-14,16-21H2,1-2H3,(H,31,33) |
| InChIKey | VBOSLEPDXVTBSW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|