C28H41Br2N3O3S — CID 22906163
6-[2-[6-[(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexylamino]ethyl]-3H-1,3-benzothiazol-2-one;dihydrobromide (PubChem CID 22906163) has the molecular formula C28H41Br2N3O3S and a molecular weight of 659.53 g/mol. Its IUPAC name is 6-[2-[6-[(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexylamino]ethyl]-3H-1,3-benzothiazol-2-one;dihydrobromide.
| Compound Name | 6-[2-[6-[(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexylamino]ethyl]-3H-1,3-benzothiazol-2-one;dihydrobromide |
|---|---|
| PubChem CID | 22906163 |
| Molecular Formula | C28H41Br2N3O3S |
| Molecular Weight | 659.53 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | 6-[2-[6-[(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexylamino]ethyl]-3H-1,3-benzothiazol-2-one;dihydrobromide |
| SMILES | Br.Br.CCCN(CCCCCCNCCc1ccc2[nH]c(=O)sc2c1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C28H39N3O3S.2BrH/c1-2-16-31(22-9-10-23-21(19-22)8-12-25(32)27(23)33)17-6-4-3-5-14-29-15-13-20-7-11-24-26(18-20)35-28(34)30-24;;/h7-8,11-12,18,22,29,32-33H,2-6,9-10,13-17,19H2,1H3,(H,30,34);2*1H |
| InChIKey | QTECUSQUNLXKRJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|