C28H44Cl2N4O3 — CID 22878028
[4-[2-[6-[[(2S)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenyl]urea;dihydrochloride (PubChem CID 22878028) has the molecular formula C28H44Cl2N4O3 and a molecular weight of 555.59 g/mol. Its IUPAC name is [4-[2-[6-[[(2S)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenyl]urea;dihydrochloride.
| Compound Name | [4-[2-[6-[[(2S)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenyl]urea;dihydrochloride |
|---|---|
| PubChem CID | 22878028 |
| Molecular Formula | C28H44Cl2N4O3 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | [4-[2-[6-[[(2S)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenyl]urea;dihydrochloride |
| SMILES | CCCN(CCCCCCNCCc1ccc(NC(N)=O)cc1)[C@H]1CCc2c(ccc(O)c2O)C1.Cl.Cl |
| InChI | InChI=1S/C28H42N4O3.2ClH/c1-2-18-32(24-12-13-25-22(20-24)9-14-26(33)27(25)34)19-6-4-3-5-16-30-17-15-21-7-10-23(11-8-21)31-28(29)35;;/h7-11,14,24,30,33-34H,2-6,12-13,15-20H2,1H3,(H3,29,31,35);2*1H/t24-;;/m0../s1 |
| InChIKey | AZOCAVYTLQTYJU-ASMAMLKCSA-N |
| XLogP | 5.39 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|