C28H44Cl2N2O5S — CID 22878041
(6S)-6-[6-[2-(4-methylsulfonylphenoxy)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol;dihydrochloride (PubChem CID 22878041) has the molecular formula C28H44Cl2N2O5S and a molecular weight of 591.64 g/mol. Its IUPAC name is (6S)-6-[6-[2-(4-methylsulfonylphenoxy)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol;dihydrochloride.
| Compound Name | (6S)-6-[6-[2-(4-methylsulfonylphenoxy)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol;dihydrochloride |
|---|---|
| PubChem CID | 22878041 |
| Molecular Formula | C28H44Cl2N2O5S |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | (6S)-6-[6-[2-(4-methylsulfonylphenoxy)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol;dihydrochloride |
| SMILES | CCCN(CCCCCCNCCOc1ccc(S(C)(=O)=O)cc1)[C@H]1CCc2c(ccc(O)c2O)C1.Cl.Cl |
| InChI | InChI=1S/C28H42N2O5S.2ClH/c1-3-18-30(23-9-14-26-22(21-23)8-15-27(31)28(26)32)19-7-5-4-6-16-29-17-20-35-24-10-12-25(13-11-24)36(2,33)34;;/h8,10-13,15,23,29,31-32H,3-7,9,14,16-21H2,1-2H3;2*1H/t23-;;/m0../s1 |
| InChIKey | SQMPCBJXNSEMEF-IFUPQEAVSA-N |
| XLogP | 5.14 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|