C27H41N3O2 — CID 70064510
(6S)-6-[propyl-[6-(3-pyridin-3-ylpropylamino)hexyl]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 70064510) has the molecular formula C27H41N3O2 and a molecular weight of 439.64 g/mol. Its IUPAC name is (6S)-6-[propyl-[6-(3-pyridin-3-ylpropylamino)hexyl]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | (6S)-6-[propyl-[6-(3-pyridin-3-ylpropylamino)hexyl]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 70064510 |
| Molecular Formula | C27H41N3O2 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.32 |
| IUPAC Name | (6S)-6-[propyl-[6-(3-pyridin-3-ylpropylamino)hexyl]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCN(CCCCCCNCCCc1cccnc1)[C@H]1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C27H41N3O2/c1-2-18-30(24-12-13-25-23(20-24)11-14-26(31)27(25)32)19-6-4-3-5-15-28-16-7-9-22-10-8-17-29-21-22/h8,10-11,14,17,21,24,28,31-32H,2-7,9,12-13,15-16,18-20H2,1H3/t24-/m0/s1 |
| InChIKey | WTHUOSZIUKQBSK-DEOSSOPVSA-N |
| XLogP | 4.84 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|