C25H36N2O5S — CID 67716485
6-[hexyl-[2-(4-methylsulfonylphenoxy)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 67716485) has the molecular formula C25H36N2O5S and a molecular weight of 476.64 g/mol. Its IUPAC name is 6-[hexyl-[2-(4-methylsulfonylphenoxy)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | 6-[hexyl-[2-(4-methylsulfonylphenoxy)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 67716485 |
| Molecular Formula | C25H36N2O5S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 6-[hexyl-[2-(4-methylsulfonylphenoxy)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCCCCN(NCCOc1ccc(S(C)(=O)=O)cc1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C25H36N2O5S/c1-3-4-5-6-16-27(20-8-13-23-19(18-20)7-14-24(28)25(23)29)26-15-17-32-21-9-11-22(12-10-21)33(2,30)31/h7,9-12,14,20,26,28-29H,3-6,8,13,15-18H2,1-2H3 |
| InChIKey | PYADITVXWPENSC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|