C28H42N2O3 — CID 67716680
1-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1-hexyl-2-[3-(4-methoxyphenyl)propyl]hydrazine (PubChem CID 67716680) has the molecular formula C28H42N2O3 and a molecular weight of 454.66 g/mol. Its IUPAC name is 1-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1-hexyl-2-[3-(4-methoxyphenyl)propyl]hydrazine.
| Compound Name | 1-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1-hexyl-2-[3-(4-methoxyphenyl)propyl]hydrazine |
|---|---|
| PubChem CID | 67716680 |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | 1-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1-hexyl-2-[3-(4-methoxyphenyl)propyl]hydrazine |
| SMILES | CCCCCCN(NCCCc1ccc(OC)cc1)C1CCc2c(ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C28H42N2O3/c1-5-6-7-8-20-30(29-19-9-10-22-11-15-25(31-2)16-12-22)24-14-17-26-23(21-24)13-18-27(32-3)28(26)33-4/h11-13,15-16,18,24,29H,5-10,14,17,19-21H2,1-4H3 |
| InChIKey | CETBFLNXCSPEFD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|