C29H43ClN2O3 — CID 22878010
2-chloro-4-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenol (PubChem CID 22878010) has the molecular formula C29H43ClN2O3 and a molecular weight of 503.13 g/mol. Its IUPAC name is 2-chloro-4-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenol.
| Compound Name | 2-chloro-4-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenol |
|---|---|
| PubChem CID | 22878010 |
| Molecular Formula | C29H43ClN2O3 |
| Molecular Weight | 503.13 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 2-chloro-4-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenol |
| SMILES | CCCN(CCCCCCNCCc1ccc(O)c(Cl)c1)[C@H]1CCc2c(ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C29H43ClN2O3/c1-4-18-32(24-11-12-25-23(21-24)10-14-28(34-2)29(25)35-3)19-8-6-5-7-16-31-17-15-22-9-13-27(33)26(30)20-22/h9-10,13-14,20,24,31,33H,4-8,11-12,15-19,21H2,1-3H3/t24-/m0/s1 |
| InChIKey | BWWUBTJMQGWZLB-DEOSSOPVSA-N |
| XLogP | 6.02 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.13 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|