C31H48N2O3 — CID 22878023
N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(4-methoxy-3-methylphenyl)ethyl]-N'-propylhexane-1,6-diamine (PubChem CID 22878023) has the molecular formula C31H48N2O3 and a molecular weight of 496.74 g/mol. Its IUPAC name is N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(4-methoxy-3-methylphenyl)ethyl]-N'-propylhexane-1,6-diamine.
| Compound Name | N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(4-methoxy-3-methylphenyl)ethyl]-N'-propylhexane-1,6-diamine |
|---|---|
| PubChem CID | 22878023 |
| Molecular Formula | C31H48N2O3 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.37 |
| IUPAC Name | N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(4-methoxy-3-methylphenyl)ethyl]-N'-propylhexane-1,6-diamine |
| SMILES | CCCN(CCCCCCNCCc1ccc(OC)c(C)c1)[C@H]1CCc2c(ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C31H48N2O3/c1-6-20-33(27-13-14-28-26(23-27)12-16-30(35-4)31(28)36-5)21-10-8-7-9-18-32-19-17-25-11-15-29(34-3)24(2)22-25/h11-12,15-16,22,27,32H,6-10,13-14,17-21,23H2,1-5H3/t27-/m0/s1 |
| InChIKey | WBKITFDPZLUAEW-MHZLTWQESA-N |
| XLogP | 5.98 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|