C31H47Cl2N3O3S — CID 23224865
6-[2-[6-[(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexyl-methylamino]ethyl]-3H-1,3-benzothiazol-2-one;dihydrochloride (PubChem CID 23224865) has the molecular formula C31H47Cl2N3O3S and a molecular weight of 612.71 g/mol. Its IUPAC name is 6-[2-[6-[(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexyl-methylamino]ethyl]-3H-1,3-benzothiazol-2-one;dihydrochloride.
| Compound Name | 6-[2-[6-[(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexyl-methylamino]ethyl]-3H-1,3-benzothiazol-2-one;dihydrochloride |
|---|---|
| PubChem CID | 23224865 |
| Molecular Formula | C31H47Cl2N3O3S |
| Molecular Weight | 612.71 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | 6-[2-[6-[(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]hexyl-methylamino]ethyl]-3H-1,3-benzothiazol-2-one;dihydrochloride |
| SMILES | CCCN(CCCCCCN(C)CCc1ccc2[nH]c(=O)sc2c1)C1CCc2c(ccc(OC)c2OC)C1.Cl.Cl |
| InChI | InChI=1S/C31H45N3O3S.2ClH/c1-5-17-34(25-12-13-26-24(22-25)11-15-28(36-3)30(26)37-4)19-9-7-6-8-18-33(2)20-16-23-10-14-27-29(21-23)38-31(35)32-27;;/h10-11,14-15,21,25H,5-9,12-13,16-20,22H2,1-4H3,(H,32,35);2*1H |
| InChIKey | FYYVPWVPUOFMBS-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.71 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|