C30H48Cl2N2O3 — CID 70065567
N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(3-methoxyphenyl)ethyl]-N'-propylhexane-1,6-diamine;dihydrochloride (PubChem CID 70065567) has the molecular formula C30H48Cl2N2O3 and a molecular weight of 555.63 g/mol. Its IUPAC name is N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(3-methoxyphenyl)ethyl]-N'-propylhexane-1,6-diamine;dihydrochloride.
| Compound Name | N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(3-methoxyphenyl)ethyl]-N'-propylhexane-1,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 70065567 |
| Molecular Formula | C30H48Cl2N2O3 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(3-methoxyphenyl)ethyl]-N'-propylhexane-1,6-diamine;dihydrochloride |
| SMILES | CCCN(CCCCCCNCCc1cccc(OC)c1)[C@H]1CCc2c(ccc(OC)c2OC)C1.Cl.Cl |
| InChI | InChI=1S/C30H46N2O3.2ClH/c1-5-20-32(26-14-15-28-25(23-26)13-16-29(34-3)30(28)35-4)21-9-7-6-8-18-31-19-17-24-11-10-12-27(22-24)33-2;;/h10-13,16,22,26,31H,5-9,14-15,17-21,23H2,1-4H3;2*1H/t26-;;/m0../s1 |
| InChIKey | RIWKTUDCJRQXNA-ROPHLPQBSA-N |
| XLogP | 6.52 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|