C29H43N3O5 — CID 22878026
4-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-2-nitrophenol (PubChem CID 22878026) has the molecular formula C29H43N3O5 and a molecular weight of 513.68 g/mol. Its IUPAC name is 4-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-2-nitrophenol.
| Compound Name | 4-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-2-nitrophenol |
|---|---|
| PubChem CID | 22878026 |
| Molecular Formula | C29H43N3O5 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | 4-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-2-nitrophenol |
| SMILES | CCCN(CCCCCCNCCc1ccc(O)c([N+](=O)[O-])c1)[C@H]1CCc2c(ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C29H43N3O5/c1-4-18-31(24-11-12-25-23(21-24)10-14-28(36-2)29(25)37-3)19-8-6-5-7-16-30-17-15-22-9-13-27(33)26(20-22)32(34)35/h9-10,13-14,20,24,30,33H,4-8,11-12,15-19,21H2,1-3H3/t24-/m0/s1 |
| InChIKey | MRZJJHXEZYBILH-DEOSSOPVSA-N |
| XLogP | 5.28 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|