C27H44Cl2N2O2S — CID 18925361
N'-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-N'-propyl-N-(2-thiophen-3-ylethyl)hexane-1,6-diamine;dihydrochloride (PubChem CID 18925361) has the molecular formula C27H44Cl2N2O2S and a molecular weight of 531.63 g/mol. Its IUPAC name is N'-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-N'-propyl-N-(2-thiophen-3-ylethyl)hexane-1,6-diamine;dihydrochloride.
| Compound Name | N'-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-N'-propyl-N-(2-thiophen-3-ylethyl)hexane-1,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 18925361 |
| Molecular Formula | C27H44Cl2N2O2S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | N'-(5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-N'-propyl-N-(2-thiophen-3-ylethyl)hexane-1,6-diamine;dihydrochloride |
| SMILES | CCCN(CCCCCCNCCc1ccsc1)C1CCc2c(ccc(OC)c2OC)C1.Cl.Cl |
| InChI | InChI=1S/C27H42N2O2S.2ClH/c1-4-17-29(18-8-6-5-7-15-28-16-13-22-14-19-32-21-22)24-10-11-25-23(20-24)9-12-26(30-2)27(25)31-3;;/h9,12,14,19,21,24,28H,4-8,10-11,13,15-18,20H2,1-3H3;2*1H |
| InChIKey | HJYFEWBUYWMKHQ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|