C26H41N3O4 — CID 22885427
5-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-1,2-oxazol-3-one (PubChem CID 22885427) has the molecular formula C26H41N3O4 and a molecular weight of 459.63 g/mol. Its IUPAC name is 5-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-1,2-oxazol-3-one.
| Compound Name | 5-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 22885427 |
| Molecular Formula | C26H41N3O4 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 5-[2-[6-[[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-1,2-oxazol-3-one |
| SMILES | CCCN(CCCCCCNCCc1cc(=O)[nH]o1)[C@H]1CCc2c(ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C26H41N3O4/c1-4-16-29(17-8-6-5-7-14-27-15-13-22-19-25(30)28-33-22)21-10-11-23-20(18-21)9-12-24(31-2)26(23)32-3/h9,12,19,21,27H,4-8,10-11,13-18H2,1-3H3,(H,28,30)/t21-/m0/s1 |
| InChIKey | MXMLNWAIGDJCII-NRFANRHFSA-N |
| XLogP | 3.95 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|