C32H50N2O4 — CID 22878060
N-[3-(3,4-dimethoxyphenyl)propyl]-N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N'-propylhexane-1,6-diamine (PubChem CID 22878060) has the molecular formula C32H50N2O4 and a molecular weight of 526.76 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N'-propylhexane-1,6-diamine.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N'-propylhexane-1,6-diamine |
|---|---|
| PubChem CID | 22878060 |
| Molecular Formula | C32H50N2O4 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.38 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N'-propylhexane-1,6-diamine |
| SMILES | CCCN(CCCCCCNCCCc1ccc(OC)c(OC)c1)[C@H]1CCc2c(ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C32H50N2O4/c1-6-21-34(27-15-16-28-26(24-27)14-18-30(36-3)32(28)38-5)22-10-8-7-9-19-33-20-11-12-25-13-17-29(35-2)31(23-25)37-4/h13-14,17-18,23,27,33H,6-12,15-16,19-22,24H2,1-5H3/t27-/m0/s1 |
| InChIKey | YVJSMHYGXNHXMS-MHZLTWQESA-N |
| XLogP | 6.07 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|