C30H46N2O3 — CID 70065669
N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(4-methoxyphenyl)ethyl]-N'-propylhexane-1,6-diamine (PubChem CID 70065669) has the molecular formula C30H46N2O3 and a molecular weight of 482.71 g/mol. Its IUPAC name is N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(4-methoxyphenyl)ethyl]-N'-propylhexane-1,6-diamine.
| Compound Name | N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(4-methoxyphenyl)ethyl]-N'-propylhexane-1,6-diamine |
|---|---|
| PubChem CID | 70065669 |
| Molecular Formula | C30H46N2O3 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.35 |
| IUPAC Name | N'-[(2S)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-N-[2-(4-methoxyphenyl)ethyl]-N'-propylhexane-1,6-diamine |
| SMILES | CCCN(CCCCCCNCCc1ccc(OC)cc1)[C@H]1CCc2c(ccc(OC)c2OC)C1 |
| InChI | InChI=1S/C30H46N2O3/c1-5-21-32(26-13-16-28-25(23-26)12-17-29(34-3)30(28)35-4)22-9-7-6-8-19-31-20-18-24-10-14-27(33-2)15-11-24/h10-12,14-15,17,26,31H,5-9,13,16,18-23H2,1-4H3/t26-/m0/s1 |
| InChIKey | PFDJCMPXTVPLTH-SANMLTNESA-N |
| XLogP | 5.67 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|