C25H37N3O4S — CID 67716754
N-[4-[2-[2-(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]phenyl]methanesulfonamide (PubChem CID 67716754) has the molecular formula C25H37N3O4S and a molecular weight of 475.66 g/mol. Its IUPAC name is N-[4-[2-[2-(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[2-(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67716754 |
| Molecular Formula | C25H37N3O4S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-[4-[2-[2-(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]phenyl]methanesulfonamide |
| SMILES | CCCCCCN(NCCc1ccc(NS(C)(=O)=O)cc1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C25H37N3O4S/c1-3-4-5-6-17-28(22-12-13-23-20(18-22)9-14-24(29)25(23)30)26-16-15-19-7-10-21(11-8-19)27-33(2,31)32/h7-11,14,22,26-27,29-30H,3-6,12-13,15-18H2,1-2H3 |
| InChIKey | RLMDZNDKXKCEJM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|