C24H33N3O5 — CID 67716619
6-[hexyl-[2-(4-hydroxy-3-nitrophenyl)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 67716619) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is 6-[hexyl-[2-(4-hydroxy-3-nitrophenyl)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | 6-[hexyl-[2-(4-hydroxy-3-nitrophenyl)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 67716619 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 6-[hexyl-[2-(4-hydroxy-3-nitrophenyl)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCCCCN(NCCc1ccc(O)c([N+](=O)[O-])c1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C24H33N3O5/c1-2-3-4-5-14-26(19-8-9-20-18(16-19)7-11-23(29)24(20)30)25-13-12-17-6-10-22(28)21(15-17)27(31)32/h6-7,10-11,15,19,25,28-30H,2-5,8-9,12-14,16H2,1H3 |
| InChIKey | QRJIABKFWVYNEI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|