C30H45N3O3 — CID 22906072
6-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 22906072) has the molecular formula C30H45N3O3 and a molecular weight of 495.71 g/mol. Its IUPAC name is 6-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | 6-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 22906072 |
| Molecular Formula | C30H45N3O3 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.35 |
| IUPAC Name | 6-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCN(CCCCCCN1CCN(c2ccccc2OC)CC1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C30H45N3O3/c1-3-16-32(25-13-14-26-24(23-25)12-15-28(34)30(26)35)18-9-5-4-8-17-31-19-21-33(22-20-31)27-10-6-7-11-29(27)36-2/h6-7,10-12,15,25,34-35H,3-5,8-9,13-14,16-23H2,1-2H3 |
| InChIKey | ODPDZLWTSCVLCT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|