C13H19N3OS — CID 18599023
N-[(4aR,8aR)-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinolin-2-yl]acetamide (PubChem CID 18599023) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is N-[(4aR,8aR)-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinolin-2-yl]acetamide.
| Compound Name | N-[(4aR,8aR)-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 18599023 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-[(4aR,8aR)-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinolin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(s1)C[C@@H]1[C@H](CCCN1C)C2 |
| InChI | InChI=1S/C13H19N3OS/c1-8(17)14-13-15-10-6-9-4-3-5-16(2)11(9)7-12(10)18-13/h9,11H,3-7H2,1-2H3,(H,14,15,17)/t9-,11-/m1/s1 |
| InChIKey | VDBVFIHDWRLQGS-MWLCHTKSSA-N |
| XLogP | 1.91 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |