C14H25Cl2N3S — CID 88521592
(4aR,8aR)-N-methyl-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinolin-2-amine;dihydrochloride (PubChem CID 88521592) has the molecular formula C14H25Cl2N3S and a molecular weight of 338.35 g/mol. Its IUPAC name is (4aR,8aR)-N-methyl-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinolin-2-amine;dihydrochloride.
| Compound Name | (4aR,8aR)-N-methyl-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinolin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 88521592 |
| Molecular Formula | C14H25Cl2N3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (4aR,8aR)-N-methyl-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinolin-2-amine;dihydrochloride |
| SMILES | CCCN1CCC[C@@H]2Cc3nc(NC)sc3C[C@H]21.Cl.Cl |
| InChI | InChI=1S/C14H23N3S.2ClH/c1-3-6-17-7-4-5-10-8-11-13(9-12(10)17)18-14(15-2)16-11;;/h10,12H,3-9H2,1-2H3,(H,15,16);2*1H/t10-,12-;;/m1../s1 |
| InChIKey | YWKQOQADWNWYTO-YNSCCRKDSA-N |
| XLogP | 3.62 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |