C14H24Cl2N2S — CID 67935585
(4aR,8aR)-2-methyl-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline;dihydrochloride (PubChem CID 67935585) has the molecular formula C14H24Cl2N2S and a molecular weight of 323.33 g/mol. Its IUPAC name is (4aR,8aR)-2-methyl-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline;dihydrochloride.
| Compound Name | (4aR,8aR)-2-methyl-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline;dihydrochloride |
|---|---|
| PubChem CID | 67935585 |
| Molecular Formula | C14H24Cl2N2S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (4aR,8aR)-2-methyl-5-propyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline;dihydrochloride |
| SMILES | CCCN1CCC[C@@H]2Cc3nc(C)sc3C[C@H]21.Cl.Cl |
| InChI | InChI=1S/C14H22N2S.2ClH/c1-3-6-16-7-4-5-11-8-12-14(9-13(11)16)17-10(2)15-12;;/h11,13H,3-9H2,1-2H3;2*1H/t11-,13-;;/m1../s1 |
| InChIKey | NMHQVUOPQGTQCE-IZUPTLQPSA-N |
| XLogP | 3.88 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |