C14H22N4 — CID 81197311
4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridin-3-amine (PubChem CID 81197311) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridin-3-amine.
| Compound Name | 4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 81197311 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridin-3-amine |
| SMILES | CN1CCCC2CN(c3ccncc3N)CCC21 |
| InChI | InChI=1S/C14H22N4/c1-17-7-2-3-11-10-18(8-5-13(11)17)14-4-6-16-9-12(14)15/h4,6,9,11,13H,2-3,5,7-8,10,15H2,1H3 |
| InChIKey | IICQYKKGDKCQDU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |