C12H18N4 — CID 90205773
4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyridin-3-amine (PubChem CID 90205773) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyridin-3-amine.
| Compound Name | 4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 90205773 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyridin-3-amine |
| SMILES | Nc1cnccc1N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C12H18N4/c13-11-8-14-4-3-12(11)16-7-6-15-5-1-2-10(15)9-16/h3-4,8,10H,1-2,5-7,9,13H2/t10-/m0/s1 |
| InChIKey | VXXDMIOQWGUXBR-JTQLQIEISA-N |
| XLogP | 0.95 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |