C11H15N5O — CID 79091949
7-(3-amino-4-pyridinyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79091949) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is 7-(3-amino-4-pyridinyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(3-amino-4-pyridinyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79091949 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 7-(3-amino-4-pyridinyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | Nc1cnccc1N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C11H15N5O/c12-9-6-13-2-1-10(9)15-3-4-16-8(7-15)5-14-11(16)17/h1-2,6,8H,3-5,7,12H2,(H,14,17) |
| InChIKey | VIPRSTZCVMSBKM-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |