C13H15FN4O3 — CID 79094464
2-amino-4-fluoro-5-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)benzoic acid (PubChem CID 79094464) has the molecular formula C13H15FN4O3 and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)benzoic acid.
| Compound Name | 2-amino-4-fluoro-5-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)benzoic acid |
|---|---|
| PubChem CID | 79094464 |
| Molecular Formula | C13H15FN4O3 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-amino-4-fluoro-5-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)benzoic acid |
| SMILES | Nc1cc(F)c(N2CCN3C(=O)NCC3C2)cc1C(=O)O |
| InChI | InChI=1S/C13H15FN4O3/c14-9-4-10(15)8(12(19)20)3-11(9)17-1-2-18-7(6-17)5-16-13(18)21/h3-4,7H,1-2,5-6,15H2,(H,16,21)(H,19,20) |
| InChIKey | AMEGYBHYGUMXRO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|