C12H16FN3O2 — CID 59743247
2-amino-4-fluoro-5-(4-methylpiperazin-1-yl)benzoic acid (PubChem CID 59743247) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-(4-methylpiperazin-1-yl)benzoic acid.
| Compound Name | 2-amino-4-fluoro-5-(4-methylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 59743247 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-amino-4-fluoro-5-(4-methylpiperazin-1-yl)benzoic acid |
| SMILES | CN1CCN(c2cc(C(=O)O)c(N)cc2F)CC1 |
| InChI | InChI=1S/C12H16FN3O2/c1-15-2-4-16(5-3-15)11-6-8(12(17)18)10(14)7-9(11)13/h6-7H,2-5,14H2,1H3,(H,17,18) |
| InChIKey | RKZIPHUIYVPIAO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|