C14H20FN3O3 — CID 107225241
2-amino-4-fluoro-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzoic acid (PubChem CID 107225241) has the molecular formula C14H20FN3O3 and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzoic acid.
| Compound Name | 2-amino-4-fluoro-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 107225241 |
| Molecular Formula | C14H20FN3O3 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-amino-4-fluoro-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzoic acid |
| SMILES | Nc1cc(F)c(N2CCCN(CCO)CC2)cc1C(=O)O |
| InChI | InChI=1S/C14H20FN3O3/c15-11-9-12(16)10(14(20)21)8-13(11)18-3-1-2-17(4-5-18)6-7-19/h8-9,19H,1-7,16H2,(H,20,21) |
| InChIKey | FVLXWSINKPZASP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|