C14H21FN4O2 — CID 107225232
2-amino-4-fluoro-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 107225232) has the molecular formula C14H21FN4O2 and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | 2-amino-4-fluoro-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 107225232 |
| Molecular Formula | C14H21FN4O2 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-amino-4-fluoro-5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | NC(=O)c1cc(N2CCCN(CCO)CC2)c(F)cc1N |
| InChI | InChI=1S/C14H21FN4O2/c15-11-9-12(16)10(14(17)21)8-13(11)19-3-1-2-18(4-5-19)6-7-20/h8-9,20H,1-7,16H2,(H2,17,21) |
| InChIKey | GTHWOAFKADTEQH-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|