C13H19F2N3O — CID 107213977
2-[4-(6-amino-2,3-difluorophenyl)-1,4-diazepan-1-yl]ethanol (PubChem CID 107213977) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[4-(6-amino-2,3-difluorophenyl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(6-amino-2,3-difluorophenyl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 107213977 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[4-(6-amino-2,3-difluorophenyl)-1,4-diazepan-1-yl]ethanol |
| SMILES | Nc1ccc(F)c(F)c1N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C13H19F2N3O/c14-10-2-3-11(16)13(12(10)15)18-5-1-4-17(6-7-18)8-9-19/h2-3,19H,1,4-9,16H2 |
| InChIKey | BWWMDJIFIYGILX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|