C12H16F2N2 — CID 62533316
2-(azepan-1-yl)-3,4-difluoroaniline (PubChem CID 62533316) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-(azepan-1-yl)-3,4-difluoroaniline.
| Compound Name | 2-(azepan-1-yl)-3,4-difluoroaniline |
|---|---|
| PubChem CID | 62533316 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-(azepan-1-yl)-3,4-difluoroaniline |
| SMILES | Nc1ccc(F)c(F)c1N1CCCCCC1 |
| InChI | InChI=1S/C12H16F2N2/c13-9-5-6-10(15)12(11(9)14)16-7-3-1-2-4-8-16/h5-6H,1-4,7-8,15H2 |
| InChIKey | WTIPINKUHSOZNW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|