C14H19F2N3O — CID 63168232
3,4-difluoro-2-(3-morpholin-4-ylpyrrolidin-1-yl)aniline (PubChem CID 63168232) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is 3,4-difluoro-2-(3-morpholin-4-ylpyrrolidin-1-yl)aniline.
| Compound Name | 3,4-difluoro-2-(3-morpholin-4-ylpyrrolidin-1-yl)aniline |
|---|---|
| PubChem CID | 63168232 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3,4-difluoro-2-(3-morpholin-4-ylpyrrolidin-1-yl)aniline |
| SMILES | Nc1ccc(F)c(F)c1N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C14H19F2N3O/c15-11-1-2-12(17)14(13(11)16)19-4-3-10(9-19)18-5-7-20-8-6-18/h1-2,10H,3-9,17H2 |
| InChIKey | YAZZIAKQZIXFMC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|