C16H22N4O — CID 102624315
2-[2-amino-5-(3-morpholin-4-ylpyrrolidin-1-yl)phenyl]acetonitrile (PubChem CID 102624315) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-[2-amino-5-(3-morpholin-4-ylpyrrolidin-1-yl)phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(3-morpholin-4-ylpyrrolidin-1-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624315 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-[2-amino-5-(3-morpholin-4-ylpyrrolidin-1-yl)phenyl]acetonitrile |
| SMILES | N#CCc1cc(N2CCC(N3CCOCC3)C2)ccc1N |
| InChI | InChI=1S/C16H22N4O/c17-5-3-13-11-14(1-2-16(13)18)20-6-4-15(12-20)19-7-9-21-10-8-19/h1-2,11,15H,3-4,6-10,12,18H2 |
| InChIKey | DQBDLLQMXXXXNR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|