C14H19N3O — CID 102624003
2-[2-amino-5-(3,3-dimethylmorpholin-4-yl)phenyl]acetonitrile (PubChem CID 102624003) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-[2-amino-5-(3,3-dimethylmorpholin-4-yl)phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(3,3-dimethylmorpholin-4-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624003 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-[2-amino-5-(3,3-dimethylmorpholin-4-yl)phenyl]acetonitrile |
| SMILES | CC1(C)COCCN1c1ccc(N)c(CC#N)c1 |
| InChI | InChI=1S/C14H19N3O/c1-14(2)10-18-8-7-17(14)12-3-4-13(16)11(9-12)5-6-15/h3-4,9H,5,7-8,10,16H2,1-2H3 |
| InChIKey | PKAMWEKXOAOTGF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|