C11H13ClF2N2 — CID 106701631
2-chloro-3,5-difluoro-4-piperidin-1-ylaniline (PubChem CID 106701631) has the molecular formula C11H13ClF2N2 and a molecular weight of 246.69 g/mol. Its IUPAC name is 2-chloro-3,5-difluoro-4-piperidin-1-ylaniline.
| Compound Name | 2-chloro-3,5-difluoro-4-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 106701631 |
| Molecular Formula | C11H13ClF2N2 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-chloro-3,5-difluoro-4-piperidin-1-ylaniline |
| SMILES | Nc1cc(F)c(N2CCCCC2)c(F)c1Cl |
| InChI | InChI=1S/C11H13ClF2N2/c12-9-8(15)6-7(13)11(10(9)14)16-4-2-1-3-5-16/h6H,1-5,15H2 |
| InChIKey | YHKMAFXIEHRBOV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|