C10H10ClF2N — CID 168512042
1-(4-chloro-2,6-difluorophenyl)pyrrolidine (PubChem CID 168512042) has the molecular formula C10H10ClF2N and a molecular weight of 217.65 g/mol. Its IUPAC name is 1-(4-chloro-2,6-difluorophenyl)pyrrolidine.
| Compound Name | 1-(4-chloro-2,6-difluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 168512042 |
| Molecular Formula | C10H10ClF2N |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 1-(4-chloro-2,6-difluorophenyl)pyrrolidine |
| SMILES | Fc1cc(Cl)cc(F)c1N1CCCC1 |
| InChI | InChI=1S/C10H10ClF2N/c11-7-5-8(12)10(9(13)6-7)14-3-1-2-4-14/h5-6H,1-4H2 |
| InChIKey | GPRRGVXFITXGTF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |