C15H17F2NO2 — CID 76983576
3-[4-(azepan-1-yl)-3,5-difluorophenyl]prop-2-enoic acid (PubChem CID 76983576) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is 3-[4-(azepan-1-yl)-3,5-difluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(azepan-1-yl)-3,5-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76983576 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-[4-(azepan-1-yl)-3,5-difluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(F)c(N2CCCCCC2)c(F)c1 |
| InChI | InChI=1S/C15H17F2NO2/c16-12-9-11(5-6-14(19)20)10-13(17)15(12)18-7-3-1-2-4-8-18/h5-6,9-10H,1-4,7-8H2,(H,19,20) |
| InChIKey | BRKHKZLMKOPNMD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|