C19H18F2N2O — CID 52666568
(E)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-3-phenylprop-2-enamide (PubChem CID 52666568) has the molecular formula C19H18F2N2O and a molecular weight of 328.36 g/mol. Its IUPAC name is (E)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 52666568 |
| Molecular Formula | C19H18F2N2O |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (E)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1cc(F)c(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C19H18F2N2O/c20-16-12-15(13-17(21)19(16)23-10-4-5-11-23)22-18(24)9-8-14-6-2-1-3-7-14/h1-3,6-9,12-13H,4-5,10-11H2,(H,22,24)/b9-8+ |
| InChIKey | BQUHUXXTPDTFKZ-CMDGGOBGSA-N |
| XLogP | 4.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|