C22H20F2N2O2 — CID 51121498
N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2-naphthalen-2-yloxyacetamide (PubChem CID 51121498) has the molecular formula C22H20F2N2O2 and a molecular weight of 382.41 g/mol. Its IUPAC name is N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 51121498 |
| Molecular Formula | C22H20F2N2O2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2-naphthalen-2-yloxyacetamide |
| SMILES | O=C(COc1ccc2ccccc2c1)Nc1cc(F)c(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C22H20F2N2O2/c23-19-12-17(13-20(24)22(19)26-9-3-4-10-26)25-21(27)14-28-18-8-7-15-5-1-2-6-16(15)11-18/h1-2,5-8,11-13H,3-4,9-10,14H2,(H,25,27) |
| InChIKey | UGEOFHLYXRKQNE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|