C20H20F2N2O3 — CID 55835649
2-(4-acetylphenoxy)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 55835649) has the molecular formula C20H20F2N2O3 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-(4-acetylphenoxy)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(4-acetylphenoxy)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55835649 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-(4-acetylphenoxy)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | CC(=O)c1ccc(OCC(=O)Nc2cc(F)c(N3CCCC3)c(F)c2)cc1 |
| InChI | InChI=1S/C20H20F2N2O3/c1-13(25)14-4-6-16(7-5-14)27-12-19(26)23-15-10-17(21)20(18(22)11-15)24-8-2-3-9-24/h4-7,10-11H,2-3,8-9,12H2,1H3,(H,23,26) |
| InChIKey | UIGWBNIWUZNGHI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|