C19H19FN2O2S — CID 2204732
N-(4-fluorophenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide (PubChem CID 2204732) has the molecular formula C19H19FN2O2S and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 2204732 |
| Molecular Formula | C19H19FN2O2S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(=S)N2CCCC2)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2O2S/c20-15-5-7-16(8-6-15)21-18(23)13-24-17-9-3-14(4-10-17)19(25)22-11-1-2-12-22/h3-10H,1-2,11-13H2,(H,21,23) |
| InChIKey | VJVZLLJTQWGSTL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|