C19H18Cl2N2O2S — CID 126248488
N-(2,4-dichlorophenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide (PubChem CID 126248488) has the molecular formula C19H18Cl2N2O2S and a molecular weight of 409.34 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126248488 |
| Molecular Formula | C19H18Cl2N2O2S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(=S)N2CCCC2)cc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O2S/c20-14-5-8-17(16(21)11-14)22-18(24)12-25-15-6-3-13(4-7-15)19(26)23-9-1-2-10-23/h3-8,11H,1-2,9-10,12H2,(H,22,24) |
| InChIKey | WSUPMRCBUKTBED-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|