C21H22Cl2N2O2S — CID 126236353
N-(2,4-dichlorophenyl)-2-[4-(4-methylpiperidine-1-carbothioyl)phenoxy]acetamide (PubChem CID 126236353) has the molecular formula C21H22Cl2N2O2S and a molecular weight of 437.39 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[4-(4-methylpiperidine-1-carbothioyl)phenoxy]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[4-(4-methylpiperidine-1-carbothioyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126236353 |
| Molecular Formula | C21H22Cl2N2O2S |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[4-(4-methylpiperidine-1-carbothioyl)phenoxy]acetamide |
| SMILES | CC1CCN(C(=S)c2ccc(OCC(=O)Nc3ccc(Cl)cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C21H22Cl2N2O2S/c1-14-8-10-25(11-9-14)21(28)15-2-5-17(6-3-15)27-13-20(26)24-19-7-4-16(22)12-18(19)23/h2-7,12,14H,8-11,13H2,1H3,(H,24,26) |
| InChIKey | CBKKEDRKTZPDIS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|