C22H23F3N2O2S — CID 126241226
2-[4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 126241226) has the molecular formula C22H23F3N2O2S and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-[4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126241226 |
| Molecular Formula | C22H23F3N2O2S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-[4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC1CCN(C(=S)c2ccc(OCC(=O)Nc3ccccc3C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H23F3N2O2S/c1-15-10-12-27(13-11-15)21(30)16-6-8-17(9-7-16)29-14-20(28)26-19-5-3-2-4-18(19)22(23,24)25/h2-9,15H,10-14H2,1H3,(H,26,28) |
| InChIKey | AAVDMMRLQCVLKI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|