C24H21F3N2O3 — CID 1182090
4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]-N-(2-phenylethyl)benzamide (PubChem CID 1182090) has the molecular formula C24H21F3N2O3 and a molecular weight of 442.44 g/mol. Its IUPAC name is 4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]-N-(2-phenylethyl)benzamide.
| Compound Name | 4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 1182090 |
| Molecular Formula | C24H21F3N2O3 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(COc1ccc(C(=O)NCCc2ccccc2)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H21F3N2O3/c25-24(26,27)20-8-4-5-9-21(20)29-22(30)16-32-19-12-10-18(11-13-19)23(31)28-15-14-17-6-2-1-3-7-17/h1-13H,14-16H2,(H,28,31)(H,29,30) |
| InChIKey | ZALZAAXMZNDBBN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |