C20H19F3N2O5 — CID 35653450
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-[(4-ethoxybenzoyl)amino]acetate (PubChem CID 35653450) has the molecular formula C20H19F3N2O5 and a molecular weight of 424.38 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-[(4-ethoxybenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-[(4-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 35653450 |
| Molecular Formula | C20H19F3N2O5 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-[(4-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccc(C(=O)NCC(=O)OCC(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N2O5/c1-2-29-14-9-7-13(8-10-14)19(28)24-11-18(27)30-12-17(26)25-16-6-4-3-5-15(16)20(21,22)23/h3-10H,2,11-12H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | KSLCIOUQXVKLMO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |