C22H25ClN2O3S — CID 126240587
N-(5-chloro-2-methylphenyl)-2-[4-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]phenoxy]acetamide (PubChem CID 126240587) has the molecular formula C22H25ClN2O3S and a molecular weight of 432.97 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[4-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]phenoxy]acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[4-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126240587 |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[4-[(2S,6S)-2,6-dimethylmorpholine-4-carbothioyl]phenoxy]acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)COc1ccc(C(=S)N2C[C@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C22H25ClN2O3S/c1-14-4-7-18(23)10-20(14)24-21(26)13-27-19-8-5-17(6-9-19)22(29)25-11-15(2)28-16(3)12-25/h4-10,15-16H,11-13H2,1-3H3,(H,24,26)/t15-,16-/m0/s1 |
| InChIKey | ZUHBIIWOQCZQEY-HOTGVXAUSA-N |
| XLogP | 4.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|