C20H22N2O2S — CID 126234591
N-(3-methylphenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide (PubChem CID 126234591) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126234591 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(3-methylphenyl)-2-[4-(pyrrolidine-1-carbothioyl)phenoxy]acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(C(=S)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C20H22N2O2S/c1-15-5-4-6-17(13-15)21-19(23)14-24-18-9-7-16(8-10-18)20(25)22-11-2-3-12-22/h4-10,13H,2-3,11-12,14H2,1H3,(H,21,23) |
| InChIKey | YISZACZPOVUVAQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|